C18H16F2N4O3S — CID 4046174
3-[4-(difluoromethoxy)phenyl]-4-[(2,3-dimethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4046174) has the molecular formula C18H16F2N4O3S and a molecular weight of 406.41 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-4-[(2,3-dimethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-4-[(2,3-dimethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4046174 |
| Molecular Formula | C18H16F2N4O3S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-4-[(2,3-dimethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cccc(C=Nn2c(-c3ccc(OC(F)F)cc3)n[nH]c2=S)c1OC |
| InChI | InChI=1S/C18H16F2N4O3S/c1-25-14-5-3-4-12(15(14)26-2)10-21-24-16(22-23-18(24)28)11-6-8-13(9-7-11)27-17(19)20/h3-10,17H,1-2H3,(H,23,28) |
| InChIKey | HTZPQYHZGABJMW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|