C12H6ClIN2OS2 — CID 107637625
3-(4-chloro-2-iodophenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 107637625) has the molecular formula C12H6ClIN2OS2 and a molecular weight of 420.68 g/mol. Its IUPAC name is 3-(4-chloro-2-iodophenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(4-chloro-2-iodophenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 107637625 |
| Molecular Formula | C12H6ClIN2OS2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 419.87 |
| IUPAC Name | 3-(4-chloro-2-iodophenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2[nH]c(=S)n1-c1ccc(Cl)cc1I |
| InChI | InChI=1S/C12H6ClIN2OS2/c13-6-1-2-9(8(14)5-6)16-11(17)7-3-4-19-10(7)15-12(16)18/h1-5H,(H,15,18) |
| InChIKey | LUCONPRFZQXLMN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|