C13H7N3OS3 — CID 107806438
3-(1,3-benzothiazol-6-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 107806438) has the molecular formula C13H7N3OS3 and a molecular weight of 317.42 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(1,3-benzothiazol-6-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 107806438 |
| Molecular Formula | C13H7N3OS3 |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2[nH]c(=S)n1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H7N3OS3/c17-12-8-3-4-19-11(8)15-13(18)16(12)7-1-2-9-10(5-7)20-6-14-9/h1-6H,(H,15,18) |
| InChIKey | NUYAXHGQWGEVRP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|