C13H8N4S2 — CID 107805933
3-(1,3-benzothiazol-6-yl)-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 107805933) has the molecular formula C13H8N4S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-(1,3-benzothiazol-6-yl)-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 107805933 |
| Molecular Formula | C13H8N4S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | S=c1[nH]c2cccnc2n1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H8N4S2/c18-13-16-10-2-1-5-14-12(10)17(13)8-3-4-9-11(6-8)19-7-15-9/h1-7H,(H,16,18) |
| InChIKey | IMLXATFXTGWTDY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|