C14H13N5S2 — CID 107805943
6-(1,3-benzothiazol-6-yl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 107805943) has the molecular formula C14H13N5S2 and a molecular weight of 315.43 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-6-yl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-(1,3-benzothiazol-6-yl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 107805943 |
| Molecular Formula | C14H13N5S2 |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 6-(1,3-benzothiazol-6-yl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H13N5S2/c1-3-9-12-13(18(2)17-9)19(14(20)16-12)8-4-5-10-11(6-8)21-7-15-10/h4-7H,3H2,1-2H3,(H,16,20) |
| InChIKey | NZEGTUBFPNBATA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|