C12H14N4S2 — CID 79302713
3-ethyl-1-methyl-6-(thiophen-2-ylmethyl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79302713) has the molecular formula C12H14N4S2 and a molecular weight of 278.41 g/mol. Its IUPAC name is 3-ethyl-1-methyl-6-(thiophen-2-ylmethyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 3-ethyl-1-methyl-6-(thiophen-2-ylmethyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79302713 |
| Molecular Formula | C12H14N4S2 |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-ethyl-1-methyl-6-(thiophen-2-ylmethyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2Cc1cccs1 |
| InChI | InChI=1S/C12H14N4S2/c1-3-9-10-11(15(2)14-9)16(12(17)13-10)7-8-5-4-6-18-8/h4-6H,3,7H2,1-2H3,(H,13,17) |
| InChIKey | LRLSCZSZNCRYMK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|