C13H15BrN4S2 — CID 106034829
6-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 106034829) has the molecular formula C13H15BrN4S2 and a molecular weight of 371.33 g/mol. Its IUPAC name is 6-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 106034829 |
| Molecular Formula | C13H15BrN4S2 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 6-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2CCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H15BrN4S2/c1-3-9-11-12(17(2)16-9)18(13(19)15-11)7-6-8-4-5-10(14)20-8/h4-5H,3,6-7H2,1-2H3,(H,15,19) |
| InChIKey | YOJIKVQNUOGALE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|