C13H12Cl2N4S — CID 79302142
6-(3,4-dichlorophenyl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79302142) has the molecular formula C13H12Cl2N4S and a molecular weight of 327.24 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-(3,4-dichlorophenyl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79302142 |
| Molecular Formula | C13H12Cl2N4S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-3-ethyl-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N4S/c1-3-10-11-12(18(2)17-10)19(13(20)16-11)7-4-5-8(14)9(15)6-7/h4-6H,3H2,1-2H3,(H,16,20) |
| InChIKey | UXRBFFBSCSOEBS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|