C13H9N5S — CID 107805988
3-(1,3-benzothiazol-6-yl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 107805988) has the molecular formula C13H9N5S and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(1,3-benzothiazol-6-yl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 107805988 |
| Molecular Formula | C13H9N5S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | Nc1nc2cccnc2n1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H9N5S/c14-13-17-10-2-1-5-15-12(10)18(13)8-3-4-9-11(6-8)19-7-16-9/h1-7H,(H2,14,17) |
| InChIKey | OCKRITMOAVURKA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |