C11H6ClN3O2S — CID 114002839
3-(1,3-benzothiazol-6-yl)-6-chloro-1H-pyrimidine-2,4-dione (PubChem CID 114002839) has the molecular formula C11H6ClN3O2S and a molecular weight of 279.71 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)-6-chloro-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(1,3-benzothiazol-6-yl)-6-chloro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 114002839 |
| Molecular Formula | C11H6ClN3O2S |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)-6-chloro-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(Cl)[nH]c(=O)n1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H6ClN3O2S/c12-9-4-10(16)15(11(17)14-9)6-1-2-7-8(3-6)18-5-13-7/h1-5H,(H,14,17) |
| InChIKey | LGTRVPQBYYFEOA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |