C10H4Cl3FN2O2 — CID 107581190
6-chloro-3-(3,5-dichloro-4-fluorophenyl)-1H-pyrimidine-2,4-dione (PubChem CID 107581190) has the molecular formula C10H4Cl3FN2O2 and a molecular weight of 309.51 g/mol. Its IUPAC name is 6-chloro-3-(3,5-dichloro-4-fluorophenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-3-(3,5-dichloro-4-fluorophenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107581190 |
| Molecular Formula | C10H4Cl3FN2O2 |
| Molecular Weight | 309.51 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 6-chloro-3-(3,5-dichloro-4-fluorophenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(Cl)[nH]c(=O)n1-c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C10H4Cl3FN2O2/c11-5-1-4(2-6(12)9(5)14)16-8(17)3-7(13)15-10(16)18/h1-3H,(H,15,18) |
| InChIKey | HYHOQZBPUHHXNH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|