C8H4Cl2FN3OS — CID 107579362
4-(3,5-dichloro-4-fluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 107579362) has the molecular formula C8H4Cl2FN3OS and a molecular weight of 280.11 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-fluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(3,5-dichloro-4-fluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 107579362 |
| Molecular Formula | C8H4Cl2FN3OS |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 278.94 |
| IUPAC Name | 4-(3,5-dichloro-4-fluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1-c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C8H4Cl2FN3OS/c9-4-1-3(2-5(10)6(4)11)14-7(15)12-13-8(14)16/h1-2H,(H,12,15)(H,13,16) |
| InChIKey | ZTXLEHRWHATZJY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|