C8H5ClFN3OS — CID 107370701
4-(3-chloro-5-fluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 107370701) has the molecular formula C8H5ClFN3OS and a molecular weight of 245.67 g/mol. Its IUPAC name is 4-(3-chloro-5-fluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(3-chloro-5-fluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 107370701 |
| Molecular Formula | C8H5ClFN3OS |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 4-(3-chloro-5-fluorophenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1-c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C8H5ClFN3OS/c9-4-1-5(10)3-6(2-4)13-7(14)11-12-8(13)15/h1-3H,(H,11,14)(H,12,15) |
| InChIKey | TZANFRJHRVYZQW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|