C13H5Cl2F3N2S — CID 107575814
3-(3,5-dichloro-4-fluorophenyl)-5,7-difluoro-1H-benzimidazole-2-thione (PubChem CID 107575814) has the molecular formula C13H5Cl2F3N2S and a molecular weight of 349.16 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-fluorophenyl)-5,7-difluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-(3,5-dichloro-4-fluorophenyl)-5,7-difluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107575814 |
| Molecular Formula | C13H5Cl2F3N2S |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 3-(3,5-dichloro-4-fluorophenyl)-5,7-difluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1cc(F)c2[nH]c(=S)n(-c3cc(Cl)c(F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C13H5Cl2F3N2S/c14-7-3-6(4-8(15)11(7)18)20-10-2-5(16)1-9(17)12(10)19-13(20)21/h1-4H,(H,19,21) |
| InChIKey | VASKEUBBTGBELJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|