C13H6ClF2N3O3 — CID 169328079
4-amino-5-(3-chloro-4,5-difluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328079) has the molecular formula C13H6ClF2N3O3 and a molecular weight of 325.66 g/mol. Its IUPAC name is 4-amino-5-(3-chloro-4,5-difluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(3-chloro-4,5-difluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328079 |
| Molecular Formula | C13H6ClF2N3O3 |
| Molecular Weight | 325.66 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 4-amino-5-(3-chloro-4,5-difluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cc(F)c(F)c(Cl)c1)C(=O)NC2=O |
| InChI | InChI=1S/C13H6ClF2N3O3/c14-6-1-4(2-7(15)10(6)16)19-8(20)3-5-9(11(19)17)13(22)18-12(5)21/h1-3H,17H2,(H,18,21,22) |
| InChIKey | PSUIWMFJVDSILX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.66 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|