C13H6F3N3O3 — CID 169326725
4-amino-5-(2,3,4-trifluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169326725) has the molecular formula C13H6F3N3O3 and a molecular weight of 309.20 g/mol. Its IUPAC name is 4-amino-5-(2,3,4-trifluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(2,3,4-trifluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169326725 |
| Molecular Formula | C13H6F3N3O3 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-amino-5-(2,3,4-trifluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(F)c(F)c1F)C(=O)NC2=O |
| InChI | InChI=1S/C13H6F3N3O3/c14-5-1-2-6(10(16)9(5)15)19-7(20)3-4-8(11(19)17)13(22)18-12(4)21/h1-3H,17H2,(H,18,21,22) |
| InChIKey | VYBGUBRMGBJNNG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|