C14H8FN3O5 — CID 169326984
4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-fluorobenzoic acid (PubChem CID 169326984) has the molecular formula C14H8FN3O5 and a molecular weight of 317.23 g/mol. Its IUPAC name is 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-fluorobenzoic acid.
| Compound Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 169326984 |
| Molecular Formula | C14H8FN3O5 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-fluorobenzoic acid |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(C(=O)O)cc1F)C(=O)NC2=O |
| InChI | InChI=1S/C14H8FN3O5/c15-7-3-5(14(22)23)1-2-8(7)18-9(19)4-6-10(11(18)16)13(21)17-12(6)20/h1-4H,16H2,(H,22,23)(H,17,20,21) |
| InChIKey | ITGKTZCGUBSTDO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|