C13H7F2N3O3 — CID 169331463
4-amino-5-(2,5-difluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169331463) has the molecular formula C13H7F2N3O3 and a molecular weight of 291.21 g/mol. Its IUPAC name is 4-amino-5-(2,5-difluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(2,5-difluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169331463 |
| Molecular Formula | C13H7F2N3O3 |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 4-amino-5-(2,5-difluorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cc(F)ccc1F)C(=O)NC2=O |
| InChI | InChI=1S/C13H7F2N3O3/c14-5-1-2-7(15)8(3-5)18-9(19)4-6-10(11(18)16)13(21)17-12(6)20/h1-4H,16H2,(H,17,20,21) |
| InChIKey | GOLDYGJSVLSRNO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|