C14H8FN3O6 — CID 169330804
3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-6-fluoro-2-hydroxybenzoic acid (PubChem CID 169330804) has the molecular formula C14H8FN3O6 and a molecular weight of 333.23 g/mol. Its IUPAC name is 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-6-fluoro-2-hydroxybenzoic acid.
| Compound Name | 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-6-fluoro-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 169330804 |
| Molecular Formula | C14H8FN3O6 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-6-fluoro-2-hydroxybenzoic acid |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(F)c(C(=O)O)c1O)C(=O)NC2=O |
| InChI | InChI=1S/C14H8FN3O6/c15-5-1-2-6(10(20)9(5)14(23)24)18-7(19)3-4-8(11(18)16)13(22)17-12(4)21/h1-3,20H,16H2,(H,23,24)(H,17,21,22) |
| InChIKey | JBPXLJFJPQLWBW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|