C15H10F2N4O4 — CID 169330722
N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2,6-difluorophenyl]acetamide (PubChem CID 169330722) has the molecular formula C15H10F2N4O4 and a molecular weight of 348.27 g/mol. Its IUPAC name is N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2,6-difluorophenyl]acetamide.
| Compound Name | N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2,6-difluorophenyl]acetamide |
|---|---|
| PubChem CID | 169330722 |
| Molecular Formula | C15H10F2N4O4 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2,6-difluorophenyl]acetamide |
| SMILES | CC(=O)Nc1c(F)ccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1F |
| InChI | InChI=1S/C15H10F2N4O4/c1-5(22)19-12-7(16)2-3-8(11(12)17)21-9(23)4-6-10(13(21)18)15(25)20-14(6)24/h2-4H,18H2,1H3,(H,19,22)(H,20,24,25) |
| InChIKey | NZQJUZKKABAEEJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|