C18H17FN4O3 — CID 169329516
4-amino-5-(3-fluoro-4-piperidin-1-ylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329516) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is 4-amino-5-(3-fluoro-4-piperidin-1-ylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(3-fluoro-4-piperidin-1-ylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329516 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-amino-5-(3-fluoro-4-piperidin-1-ylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(N3CCCCC3)c(F)c1)C(=O)NC2=O |
| InChI | InChI=1S/C18H17FN4O3/c19-12-8-10(4-5-13(12)22-6-2-1-3-7-22)23-14(24)9-11-15(16(23)20)18(26)21-17(11)25/h4-5,8-9H,1-3,6-7,20H2,(H,21,25,26) |
| InChIKey | BSXHXZFAFMPOGU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|