C14H12BN3O5 — CID 169330068
[5-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methylphenyl]boronic acid (PubChem CID 169330068) has the molecular formula C14H12BN3O5 and a molecular weight of 313.08 g/mol. Its IUPAC name is [5-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methylphenyl]boronic acid.
| Compound Name | [5-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 169330068 |
| Molecular Formula | C14H12BN3O5 |
| Molecular Weight | 313.08 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [5-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methylphenyl]boronic acid |
| SMILES | Cc1ccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1B(O)O |
| InChI | InChI=1S/C14H12BN3O5/c1-6-2-3-7(4-9(6)15(22)23)18-10(19)5-8-11(12(18)16)14(21)17-13(8)20/h2-5,22-23H,16H2,1H3,(H,17,20,21) |
| InChIKey | RCXCALSSMGBKHN-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.08 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|