C16H12N6O3 — CID 169328100
4-amino-5-[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328100) has the molecular formula C16H12N6O3 and a molecular weight of 336.31 g/mol. Its IUPAC name is 4-amino-5-[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328100 |
| Molecular Formula | C16H12N6O3 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-amino-5-[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Cc1ccc(-n2cnnc2)cc1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C16H12N6O3/c1-8-2-3-9(21-6-18-19-7-21)4-11(8)22-12(23)5-10-13(14(22)17)16(25)20-15(10)24/h2-7H,17H2,1H3,(H,20,24,25) |
| InChIKey | SEQSNNICVCPCIO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|