C17H13N5O3 — CID 169328764
4-amino-5-(4-imidazol-1-yl-2-methylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328764) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is 4-amino-5-(4-imidazol-1-yl-2-methylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(4-imidazol-1-yl-2-methylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328764 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-amino-5-(4-imidazol-1-yl-2-methylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Cc1cc(-n2ccnc2)ccc1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C17H13N5O3/c1-9-6-10(21-5-4-19-8-21)2-3-12(9)22-13(23)7-11-14(15(22)18)17(25)20-16(11)24/h2-8H,18H2,1H3,(H,20,24,25) |
| InChIKey | UHNOPLHPUJXXAA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|