C24H25N3O3 — CID 169330653
5-[5-(1-adamantyl)-2-methylphenyl]-4-aminopyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330653) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-[5-(1-adamantyl)-2-methylphenyl]-4-aminopyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 5-[5-(1-adamantyl)-2-methylphenyl]-4-aminopyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330653 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 5-[5-(1-adamantyl)-2-methylphenyl]-4-aminopyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Cc1ccc(C23CC4CC(CC(C4)C2)C3)cc1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C24H25N3O3/c1-12-2-3-16(24-9-13-4-14(10-24)6-15(5-13)11-24)7-18(12)27-19(28)8-17-20(21(27)25)23(30)26-22(17)29/h2-3,7-8,13-15H,4-6,9-11,25H2,1H3,(H,26,29,30) |
| InChIKey | ZEUBUKAEDYFCJM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|