C25H27N3O5 — CID 169329827
5-[2-(1-adamantyl)-4,5-dimethoxyphenyl]-4-aminopyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329827) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 5-[2-(1-adamantyl)-4,5-dimethoxyphenyl]-4-aminopyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 5-[2-(1-adamantyl)-4,5-dimethoxyphenyl]-4-aminopyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329827 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 5-[2-(1-adamantyl)-4,5-dimethoxyphenyl]-4-aminopyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | COc1cc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c(C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C25H27N3O5/c1-32-18-7-16(25-9-12-3-13(10-25)5-14(4-12)11-25)17(8-19(18)33-2)28-20(29)6-15-21(22(28)26)24(31)27-23(15)30/h6-8,12-14H,3-5,9-11,26H2,1-2H3,(H,27,30,31) |
| InChIKey | KROXNUPZQBMHCR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|