C15H13N3O5S — CID 169329567
4-amino-5-(4,5-dimethoxy-2-sulfanylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329567) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is 4-amino-5-(4,5-dimethoxy-2-sulfanylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(4,5-dimethoxy-2-sulfanylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329567 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-amino-5-(4,5-dimethoxy-2-sulfanylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | COc1cc(S)c(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1OC |
| InChI | InChI=1S/C15H13N3O5S/c1-22-8-4-7(10(24)5-9(8)23-2)18-11(19)3-6-12(13(18)16)15(21)17-14(6)20/h3-5,24H,16H2,1-2H3,(H,17,20,21) |
| InChIKey | PLYOJKLZMVUCCH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|