C22H16ClN3O6 — CID 169327474
4-amino-5-[2-(4-chlorobenzoyl)-4,5-dimethoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169327474) has the molecular formula C22H16ClN3O6 and a molecular weight of 453.84 g/mol. Its IUPAC name is 4-amino-5-[2-(4-chlorobenzoyl)-4,5-dimethoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[2-(4-chlorobenzoyl)-4,5-dimethoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169327474 |
| Molecular Formula | C22H16ClN3O6 |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 4-amino-5-[2-(4-chlorobenzoyl)-4,5-dimethoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | COc1cc(C(=O)c2ccc(Cl)cc2)c(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1OC |
| InChI | InChI=1S/C22H16ClN3O6/c1-31-15-7-12(19(28)10-3-5-11(23)6-4-10)14(9-16(15)32-2)26-17(27)8-13-18(20(26)24)22(30)25-21(13)29/h3-9H,24H2,1-2H3,(H,25,29,30) |
| InChIKey | XKILYTCAGVWHET-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|