C18H16N4O5 — CID 169327765
3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-cyclopropyl-4-methoxybenzamide (PubChem CID 169327765) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-cyclopropyl-4-methoxybenzamide.
| Compound Name | 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-cyclopropyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 169327765 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-N-cyclopropyl-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CC2)cc1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C18H16N4O5/c1-27-12-5-2-8(16(24)20-9-3-4-9)6-11(12)22-13(23)7-10-14(15(22)19)18(26)21-17(10)25/h2,5-7,9H,3-4,19H2,1H3,(H,20,24)(H,21,25,26) |
| InChIKey | MAYLHTUHNHAJRJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|