C16H14N4O6 — CID 169330065
2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4,5-dimethoxybenzamide (PubChem CID 169330065) has the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. Its IUPAC name is 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4,5-dimethoxybenzamide.
| Compound Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 169330065 |
| Molecular Formula | C16H14N4O6 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)c(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1OC |
| InChI | InChI=1S/C16H14N4O6/c1-25-9-3-6(14(18)22)8(5-10(9)26-2)20-11(21)4-7-12(13(20)17)16(24)19-15(7)23/h3-5H,17H2,1-2H3,(H2,18,22)(H,19,23,24) |
| InChIKey | RJAHYZZYIDZNDJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|