C15H9BrN4O4 — CID 169330728
2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-bromo-4-methoxybenzonitrile (PubChem CID 169330728) has the molecular formula C15H9BrN4O4 and a molecular weight of 389.17 g/mol. Its IUPAC name is 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-bromo-4-methoxybenzonitrile.
| Compound Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-bromo-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 169330728 |
| Molecular Formula | C15H9BrN4O4 |
| Molecular Weight | 389.17 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-bromo-4-methoxybenzonitrile |
| SMILES | COc1cc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c(C#N)cc1Br |
| InChI | InChI=1S/C15H9BrN4O4/c1-24-10-4-9(6(5-17)2-8(10)16)20-11(21)3-7-12(13(20)18)15(23)19-14(7)22/h2-4H,18H2,1H3,(H,19,22,23) |
| InChIKey | DIPVKJXVPPULOF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|