C14H5Br2FN4O3 — CID 169327158
2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3,5-dibromo-6-fluorobenzonitrile (PubChem CID 169327158) has the molecular formula C14H5Br2FN4O3 and a molecular weight of 456.03 g/mol. Its IUPAC name is 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3,5-dibromo-6-fluorobenzonitrile.
| Compound Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3,5-dibromo-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 169327158 |
| Molecular Formula | C14H5Br2FN4O3 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 453.87 |
| IUPAC Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3,5-dibromo-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)c(Br)cc(Br)c1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C14H5Br2FN4O3/c15-6-2-7(16)11(5(3-18)10(6)17)21-8(22)1-4-9(12(21)19)14(24)20-13(4)23/h1-2H,19H2,(H,20,23,24) |
| InChIKey | HHBQSOQLUNOZTA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|