C13H5Br2Cl2N3O3 — CID 169327157
4-amino-5-(4,6-dibromo-2,3-dichlorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169327157) has the molecular formula C13H5Br2Cl2N3O3 and a molecular weight of 481.92 g/mol. Its IUPAC name is 4-amino-5-(4,6-dibromo-2,3-dichlorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(4,6-dibromo-2,3-dichlorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169327157 |
| Molecular Formula | C13H5Br2Cl2N3O3 |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 478.81 |
| IUPAC Name | 4-amino-5-(4,6-dibromo-2,3-dichlorophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1c(Br)cc(Br)c(Cl)c1Cl)C(=O)NC2=O |
| InChI | InChI=1S/C13H5Br2Cl2N3O3/c14-4-2-5(15)10(9(17)8(4)16)20-6(21)1-3-7(11(20)18)13(23)19-12(3)22/h1-2H,18H2,(H,19,22,23) |
| InChIKey | XPILFRHFGQFAQY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|