C13H6BrClN4O5 — CID 169328862
4-amino-5-(6-bromo-3-chloro-2-nitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328862) has the molecular formula C13H6BrClN4O5 and a molecular weight of 413.57 g/mol. Its IUPAC name is 4-amino-5-(6-bromo-3-chloro-2-nitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(6-bromo-3-chloro-2-nitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328862 |
| Molecular Formula | C13H6BrClN4O5 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 411.92 |
| IUPAC Name | 4-amino-5-(6-bromo-3-chloro-2-nitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1c(Br)ccc(Cl)c1[N+](=O)[O-])C(=O)NC2=O |
| InChI | InChI=1S/C13H6BrClN4O5/c14-5-1-2-6(15)10(19(23)24)9(5)18-7(20)3-4-8(11(18)16)13(22)17-12(4)21/h1-3H,16H2,(H,17,21,22) |
| InChIKey | SVNKPJHBZOSPOG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|