C17H16BrN3O3 — CID 169327103
4-amino-5-(4-bromo-2,6-diethylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169327103) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is 4-amino-5-(4-bromo-2,6-diethylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(4-bromo-2,6-diethylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169327103 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 4-amino-5-(4-bromo-2,6-diethylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CCc1cc(Br)cc(CC)c1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C17H16BrN3O3/c1-3-8-5-10(18)6-9(4-2)14(8)21-12(22)7-11-13(15(21)19)17(24)20-16(11)23/h5-7H,3-4,19H2,1-2H3,(H,20,23,24) |
| InChIKey | JWAIVLJUVJRGLU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|