C14H8N4O4 — CID 169330386
2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-hydroxybenzonitrile (PubChem CID 169330386) has the molecular formula C14H8N4O4 and a molecular weight of 296.24 g/mol. Its IUPAC name is 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-hydroxybenzonitrile.
| Compound Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-hydroxybenzonitrile |
|---|---|
| PubChem CID | 169330386 |
| Molecular Formula | C14H8N4O4 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-hydroxybenzonitrile |
| SMILES | N#Cc1cccc(O)c1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C14H8N4O4/c15-5-6-2-1-3-8(19)11(6)18-9(20)4-7-10(12(18)16)14(22)17-13(7)21/h1-4,19H,16H2,(H,17,21,22) |
| InChIKey | TWLTWXKJUOXOAV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|