C20H12N4O3 — CID 169330096
3-[2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]benzonitrile (PubChem CID 169330096) has the molecular formula C20H12N4O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 3-[2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]benzonitrile.
| Compound Name | 3-[2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 169330096 |
| Molecular Formula | C20H12N4O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-[2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccccc2-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C20H12N4O3/c21-10-11-4-3-5-12(8-11)13-6-1-2-7-15(13)24-16(25)9-14-17(18(24)22)20(27)23-19(14)26/h1-9H,22H2,(H,23,26,27) |
| InChIKey | CCUXKXMMXSMQLE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|