C15H10N4O4 — CID 169330984
4-amino-5-(3-oxo-1,2-dihydroisoindol-4-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330984) has the molecular formula C15H10N4O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is 4-amino-5-(3-oxo-1,2-dihydroisoindol-4-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(3-oxo-1,2-dihydroisoindol-4-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330984 |
| Molecular Formula | C15H10N4O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-amino-5-(3-oxo-1,2-dihydroisoindol-4-yl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cccc3c1C(=O)NC3)C(=O)NC2=O |
| InChI | InChI=1S/C15H10N4O4/c16-12-11-7(13(21)18-15(11)23)4-9(20)19(12)8-3-1-2-6-5-17-14(22)10(6)8/h1-4H,5,16H2,(H,17,22)(H,18,21,23) |
| InChIKey | ZRGJUCKSROZMHT-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|