C15H11N3O5 — CID 169331643
3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methylbenzoic acid (PubChem CID 169331643) has the molecular formula C15H11N3O5 and a molecular weight of 313.27 g/mol. Its IUPAC name is 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methylbenzoic acid.
| Compound Name | 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 169331643 |
| Molecular Formula | C15H11N3O5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C15H11N3O5/c1-6-7(15(22)23)3-2-4-9(6)18-10(19)5-8-11(12(18)16)14(21)17-13(8)20/h2-5H,16H2,1H3,(H,22,23)(H,17,20,21) |
| InChIKey | HFMAOYPOCMNJTK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|