C14H8N4O7 — CID 169331249
2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-nitrobenzoic acid (PubChem CID 169331249) has the molecular formula C14H8N4O7 and a molecular weight of 344.24 g/mol. Its IUPAC name is 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-nitrobenzoic acid.
| Compound Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 169331249 |
| Molecular Formula | C14H8N4O7 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-nitrobenzoic acid |
| SMILES | Nc1c2c(cc(=O)n1-c1cc([N+](=O)[O-])ccc1C(=O)O)C(=O)NC2=O |
| InChI | InChI=1S/C14H8N4O7/c15-11-10-7(12(20)16-13(10)21)4-9(19)17(11)8-3-5(18(24)25)1-2-6(8)14(22)23/h1-4H,15H2,(H,22,23)(H,16,20,21) |
| InChIKey | XLXVCGUQYSXLTG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 174.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|