C13H8N4O8S — CID 169331607
4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-nitrobenzenesulfonic acid (PubChem CID 169331607) has the molecular formula C13H8N4O8S and a molecular weight of 380.29 g/mol. Its IUPAC name is 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-nitrobenzenesulfonic acid.
| Compound Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 169331607 |
| Molecular Formula | C13H8N4O8S |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-nitrobenzenesulfonic acid |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(S(=O)(=O)O)cc1[N+](=O)[O-])C(=O)NC2=O |
| InChI | InChI=1S/C13H8N4O8S/c14-11-10-6(12(19)15-13(10)20)4-9(18)16(11)7-2-1-5(26(23,24)25)3-8(7)17(21)22/h1-4H,14H2,(H,15,19,20)(H,23,24,25) |
| InChIKey | OBBHGXRPLJQQDV-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 191.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|