C14H9N5O8 — CID 169331377
4-amino-5-(4-methoxy-3,5-dinitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169331377) has the molecular formula C14H9N5O8 and a molecular weight of 375.25 g/mol. Its IUPAC name is 4-amino-5-(4-methoxy-3,5-dinitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(4-methoxy-3,5-dinitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169331377 |
| Molecular Formula | C14H9N5O8 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 4-amino-5-(4-methoxy-3,5-dinitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | COc1c([N+](=O)[O-])cc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9N5O8/c1-27-11-7(18(23)24)2-5(3-8(11)19(25)26)17-9(20)4-6-10(12(17)15)14(22)16-13(6)21/h2-4H,15H2,1H3,(H,16,21,22) |
| InChIKey | KHOSTFFUTVAAIL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 189.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|