C13H8N4O6 — CID 169331593
4-amino-5-(4-hydroxy-2-nitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169331593) has the molecular formula C13H8N4O6 and a molecular weight of 316.23 g/mol. Its IUPAC name is 4-amino-5-(4-hydroxy-2-nitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(4-hydroxy-2-nitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169331593 |
| Molecular Formula | C13H8N4O6 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-amino-5-(4-hydroxy-2-nitrophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(O)cc1[N+](=O)[O-])C(=O)NC2=O |
| InChI | InChI=1S/C13H8N4O6/c14-11-10-6(12(20)15-13(10)21)4-9(19)16(11)7-2-1-5(18)3-8(7)17(22)23/h1-4,18H,14H2,(H,15,20,21) |
| InChIKey | SWUZXPSUUCPFLY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|