C16H14N4O5S — CID 169330458
4-amino-5-(2-nitro-5-propylsulfanylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330458) has the molecular formula C16H14N4O5S and a molecular weight of 374.38 g/mol. Its IUPAC name is 4-amino-5-(2-nitro-5-propylsulfanylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(2-nitro-5-propylsulfanylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330458 |
| Molecular Formula | C16H14N4O5S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 4-amino-5-(2-nitro-5-propylsulfanylphenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CCCSc1ccc([N+](=O)[O-])c(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C16H14N4O5S/c1-2-5-26-8-3-4-10(20(24)25)11(6-8)19-12(21)7-9-13(14(19)17)16(23)18-15(9)22/h3-4,6-7H,2,5,17H2,1H3,(H,18,22,23) |
| InChIKey | CPLZYIAKUVRZCK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|