C15H10F2N4O6 — CID 169330525
4-amino-5-[2-(2,2-difluoroethoxy)-5-nitrophenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330525) has the molecular formula C15H10F2N4O6 and a molecular weight of 380.26 g/mol. Its IUPAC name is 4-amino-5-[2-(2,2-difluoroethoxy)-5-nitrophenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[2-(2,2-difluoroethoxy)-5-nitrophenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330525 |
| Molecular Formula | C15H10F2N4O6 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 4-amino-5-[2-(2,2-difluoroethoxy)-5-nitrophenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cc([N+](=O)[O-])ccc1OCC(F)F)C(=O)NC2=O |
| InChI | InChI=1S/C15H10F2N4O6/c16-10(17)5-27-9-2-1-6(21(25)26)3-8(9)20-11(22)4-7-12(13(20)18)15(24)19-14(7)23/h1-4,10H,5,18H2,(H,19,23,24) |
| InChIKey | QMLVLLMCOKMFPS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|