C15H12IN3O4 — CID 169330744
4-amino-5-(2-ethoxy-5-iodophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330744) has the molecular formula C15H12IN3O4 and a molecular weight of 425.18 g/mol. Its IUPAC name is 4-amino-5-(2-ethoxy-5-iodophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-(2-ethoxy-5-iodophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330744 |
| Molecular Formula | C15H12IN3O4 |
| Molecular Weight | 425.18 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 4-amino-5-(2-ethoxy-5-iodophenyl)pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CCOc1ccc(I)cc1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C15H12IN3O4/c1-2-23-10-4-3-7(16)5-9(10)19-11(20)6-8-12(13(19)17)15(22)18-14(8)21/h3-6H,2,17H2,1H3,(H,18,21,22) |
| InChIKey | XTDYULVLPHUNFZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|