C9H6F2N2O3 — CID 82003857
2-(2,2-difluoroethoxy)-5-nitrobenzonitrile (PubChem CID 82003857) has the molecular formula C9H6F2N2O3 and a molecular weight of 228.15 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-5-nitrobenzonitrile.
| Compound Name | 2-(2,2-difluoroethoxy)-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 82003857 |
| Molecular Formula | C9H6F2N2O3 |
| Molecular Weight | 228.15 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1OCC(F)F |
| InChI | InChI=1S/C9H6F2N2O3/c10-9(11)5-16-8-2-1-7(13(14)15)3-6(8)4-12/h1-3,9H,5H2 |
| InChIKey | HKNIKPNMOOUDTJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|