C14H6F4N4O5 — CID 169328618
4-amino-5-[5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328618) has the molecular formula C14H6F4N4O5 and a molecular weight of 386.22 g/mol. Its IUPAC name is 4-amino-5-[5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328618 |
| Molecular Formula | C14H6F4N4O5 |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 4-amino-5-[5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cc(F)c(C(F)(F)F)cc1[N+](=O)[O-])C(=O)NC2=O |
| InChI | InChI=1S/C14H6F4N4O5/c15-6-3-7(8(22(26)27)2-5(6)14(16,17)18)21-9(23)1-4-10(11(21)19)13(25)20-12(4)24/h1-3H,19H2,(H,20,24,25) |
| InChIKey | HIMIBNLVKHRGND-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|