C16H13N5O7 — CID 169328647
ethyl N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-nitrophenyl]carbamate (PubChem CID 169328647) has the molecular formula C16H13N5O7 and a molecular weight of 387.31 g/mol. Its IUPAC name is ethyl N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-nitrophenyl]carbamate.
| Compound Name | ethyl N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 169328647 |
| Molecular Formula | C16H13N5O7 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | ethyl N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-nitrophenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N5O7/c1-2-28-16(25)18-9-4-3-7(5-10(9)21(26)27)20-11(22)6-8-12(13(20)17)15(24)19-14(8)23/h3-6H,2,17H2,1H3,(H,18,25)(H,19,23,24) |
| InChIKey | JIDFUJWQNWPZAK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 175.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|