C15H14N4O6S — CID 169327804
N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methoxyphenyl]methanesulfonamide (PubChem CID 169327804) has the molecular formula C15H14N4O6S and a molecular weight of 378.37 g/mol. Its IUPAC name is N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 169327804 |
| Molecular Formula | C15H14N4O6S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methoxyphenyl]methanesulfonamide |
| SMILES | COc1cc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C15H14N4O6S/c1-25-10-5-7(3-4-9(10)18-26(2,23)24)19-11(20)6-8-12(13(19)16)15(22)17-14(8)21/h3-6,18H,16H2,1-2H3,(H,17,21,22) |
| InChIKey | YASZGKDPRKBALU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 149.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|